|
|
|
Zouping Mingxing Chemical Co., Ltd.is a supplier of
|
 |
Octadecanedioic acid mono-tert-butyl ester |
|
|
This listing includes other chemicals and chemical products supplied by Zouping Mingxing Chemical Co., Ltd..
Click the line at a product and you will get the email form to send an inquiry.
|
|
|
| Product names |
CAS numbers |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Information on Zouping Mingxing Chemical Co., Ltd. |
Zouping Mingxing Chemical Co.,Ltd. established in 2002. It is one of subsidiary company of Shandong Liangzou Mining Group and covers the floor area of 48000 square meters, with the total investment of 350 million yuan. Now, the company has 56 professional technicians and long-term invites doctor and postdoctor to guide the works, mainly produces more than 100 kinds of pharmaceutical intermediate,pesticide intermediate,flavor & fragrance materials and textile auxiliary agent materials such as diallylamine, allylamine, triallylamine, dichloride, allylalcohol, allylacetate, allylcaproate, allylphenoxyacetate, allyl heptylate，Isopropyl Acetate, Acetyl acetone，allyl bromide，dibromomethane， 1,3-Propanediol, 1,3-Dichloropropane, 1-bromo-3-chloropropane, 1,3-Dibromopropane, 3-Chloro-1-propanol, 3-Bromo-1-propanol, N-methyldiallylamine, N-methylallylamine, etc.
So far, the company have 15 workshops and produce over 40000ts chemicals yearly.we have enough capacity to supply you and establish the steady cooperation relations. Moreover, we can help you produce the product that you need based on the technology cooperation and our equipments.
|
|
Zouping Mingxing Chemical Co., Ltd. also offers: Octadecanedioic acid Octadearyl dimethyl ammonium chloride o-Phenylphenol o-Phenylenediamine o-Phenanthroline o-Carborane Neopentylglycol diacrylate Neopentyl alcohol N-[tris-(Hydroxymethyl)methyl]acrylamide N-[3-(Dimethylamino)propyl]dodecanamide N-Vinylcaprolactam N-Vinyl-2-pyrrolidone n-Propyl cinnamate n-Propyl bromide N-Propan-2-ylprop-2-enamide N-Phenylacrylamide n-Pentyl chloride N-Oleyl-1,3-propyl diamine N-Octylpyridin-4-amine N-Methylolacrylamide N-Methyldidodecylamine N-Methylallylamine N-Methyl-n-propylamine N-Methyl-n-(n,N-dimethylaminoethyl)-aminoethanol N-Methyl-N,N-dioctadecyl-1-octadecanaminium chloride N-Methyl diallylamine hydrochloride N-Isopropylmethylamine N-Hydroxyphthalimide n-Hexadecyltrimethylammonium chloride N-Ethyl-3-trimethoxysilyl-2-methylpropanamine N-Ethyl-2-pyrrolidone N-Ethyl-2-methylallylamine N-Cocoalkyl-1,3-diaminopropane N-Chlorosuccinimide N-Bromosuccinimide N-Benzylacrylamide N-3-(Hydrogenated cocoamido) propyl dimethylamines N-(tert-Butyl)benzylamine N-(p-Chlorobenzoyl)-N-(p-methoxyphenyl)hydrazine N-(4-Sulfamoylphenyl)prop-2-enamide N-(3-Chloropropyl)morpholine N-(3-Chloropropyl)dibutylamine N-(3-Aminopropyl)imidazole N-(3-Aminophenyl) acetamide N-(3-(Trimethoxysilyl)propyl)butylamine N-(2-Methylphenyl)-2-(propylamino)propanamide N-(2-Hydroxyethyl)pyrrolidine N-(2-Hydroxyethyl)-4-aza-9-crown-3 N-(2-Aminoethyl)pyrrolidine N,O-bis-(Trimethylsilyl)acetamide (BSA)
|
|
|
| Octadecanedioic acid mono-tert-butyl ester is offered by other companies |
Shandong Juntai Pharmaceutical Co., Ltd.
|
Shanghai Ruiyi Medical Tech Co.,Ltd
Ruiyi Tech was founded in May, 2006 and composed of Shanghai Ruiyi Medical Tech Co., Ltd., Shanghai Ruiheda Pharmaceutical Technology Co., Ltd., Haimen Ruiyi Medical Tech Co., Ltd., Nantong Ruiheda Pharmaceutical Technology Co., Ltd., Hechi Ruiyi" ....
Send an inquiry on Octadecanedioic acid mono-tert-butyl ester to the supplier Shanghai Ruiyi Medical Tech Co.,Ltd
|
Allfluoro Pharmaceutical Co. Ltd.
|
Dayang Chem (Hangzhou) Co.,Ltd.
|
Leap Chem Co., Ltd
|
Chemos GmbH & Co. KG
|
|
|
|
|
|